CAS 172823-13-1 appears in our catalog under these names: (R)-3-Amino-4-methyl-pentanoic acid methyl ester hydrochloride, 97%, Methyl (R)-homo-beta-valinate hydrochloride, (R)-Methyl 3-amino-4-methylpentanoate hydrochloride 97%, (R)-Methyl 3-amino-4-methylpentanoate hydrochloride, 97%, 97%, Methyl (R)-homo-beta-valinate hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl (3R)-3-amino-4-methylpentanoate;hydrochloride (CAS 172823-13-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (3R)-3-amino-4-methylpentanoate;hydrochloride. InChIKey: PPXNDBYZDBBPCL-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (3R)-3-amino-4-methylpentanoate;hydrochloride |
| InChIKey | PPXNDBYZDBBPCL-FYZOBXCZSA-N |
| SMILES | CC(C)[C@@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)