Products 1423032-09-0

CAS 1423032-09-0 appears in our catalog under these names: 3-Amino-2-((2-methylphenyl)methyl)propanoic acid hydrochloride, 95%, 3-Amino-2-((2-methylphenyl)methyl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(aminomethyl)-3-(2-methylphenyl)propanoic acid;hydrochloride (CAS 1423032-09-0) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 2-(aminomethyl)-3-(2-methylphenyl)propanoic acid;hydrochloride. InChIKey: XGXOCNILSQMZDA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO2
Molecular weight229.70 g/mol
IUPAC name2-(aminomethyl)-3-(2-methylphenyl)propanoic acid;hydrochloride
InChIKeyXGXOCNILSQMZDA-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1CC(CN)C(=O)O.Cl

Computed by PubChem (NCBI)