Products 1423032-63-6

CAS 1423032-63-6 is the registry number for 3,5-Diethyl-1-methyl-1H-pyrazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3,5-diethyl-1-methylpyrazole-4-sulfonyl chloride (CAS 1423032-63-6) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 3,5-diethyl-1-methylpyrazole-4-sulfonyl chloride. InChIKey: WEXDXTYRQWMMJU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2S
Molecular weight236.72 g/mol
IUPAC name3,5-diethyl-1-methylpyrazole-4-sulfonyl chloride
InChIKeyWEXDXTYRQWMMJU-UHFFFAOYSA-N
SMILESCCC1=C(C(=NN1C)CC)S(=O)(=O)Cl

Computed by PubChem (NCBI)