CAS 1423033-43-5 appears in our catalog under these names: methyl 6–cyano–2–oxaspiro(3·3)heptane–6–carboxylate, Methyl 6-cyano-2-oxaspiro(3.3)heptane-6-carboxylate. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 50mg, 0,5g.
Methyl 6-cyano-2-oxaspiro[3.3]heptane-6-carboxylate (CAS 1423033-43-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 6-cyano-2-oxaspiro[3.3]heptane-6-carboxylate. InChIKey: MINVJBSZZWVFIH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl 6-cyano-2-oxaspiro[3.3]heptane-6-carboxylate |
| InChIKey | MINVJBSZZWVFIH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC2(C1)COC2)C#N |
Computed by PubChem (NCBI)