CAS 14262-20-5 appears in our catalog under these names: 2-Methyl-3-oxoisoindoline-4-carboxylic acid, 95%, 2-Methyl-3-oxo-2,3-dihydro-1 H -isoindole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-methyl-3-oxo-1H-isoindole-4-carboxylic acid (CAS 14262-20-5) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-methyl-3-oxo-1H-isoindole-4-carboxylic acid. InChIKey: DUMZHWJYINJEAY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-methyl-3-oxo-1H-isoindole-4-carboxylic acid |
| InChIKey | DUMZHWJYINJEAY-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C1=O)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)