Products 142629-43-4
CAS 142629-43-4 is the registry number for WAY-166818. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-hydroxyphenyl)-1,3-benzoxazol-5-ol (CAS 142629-43-4) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1,3-benzoxazol-5-ol. InChIKey: DPAMLAKLEWYMGF-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1,3-benzoxazol-5-ol |
| InChIKey | DPAMLAKLEWYMGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)O)O |
Computed by PubChem (NCBI)