Products 1426338-28-4
CAS 1426338-28-4 is the registry number for 4-Cyano-2-(methylthio)benzoic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-cyano-2-methylsulfanylbenzoic acid (CAS 1426338-28-4) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 4-cyano-2-methylsulfanylbenzoic acid. InChIKey: WKRHTRDHUNNLRX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 4-cyano-2-methylsulfanylbenzoic acid |
| InChIKey | WKRHTRDHUNNLRX-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=CC(=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-cyano-2-(methylthio)benzoic acid