CAS 1428940-28-6 is the registry number for 4-cyano-2-fluoro-benzohydrazide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
4-cyano-2-fluorobenzohydrazide (CAS 1428940-28-6) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 4-cyano-2-fluorobenzohydrazide. InChIKey: BXGFFESBJWYKEO-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 4-cyano-2-fluorobenzohydrazide |
| InChIKey | BXGFFESBJWYKEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)F)C(=O)NN |
Computed by PubChem (NCBI)