CAS 142955-51-9 is the registry number for Boc-L-Phenylalanine N-carboxyanhydride. Offered by: Creative Peptides. Available pack sizes: on request.
Tert-butyl (4S)-4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS 142955-51-9) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: tert-butyl (4S)-4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate. InChIKey: MFGBEMRROYABSH-NSHDSACASA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | tert-butyl (4S)-4-benzyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| InChIKey | MFGBEMRROYABSH-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C(=O)OC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)