CAS 1429901-24-5 appears in our catalog under these names: 5-Benzyl-2-methyl-1,3-thiazole-4-carboxylic acid, 95%, 5-Benzyl-2-methyl-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-benzyl-2-methyl-1,3-thiazole-4-carboxylic acid (CAS 1429901-24-5) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 5-benzyl-2-methyl-1,3-thiazole-4-carboxylic acid. InChIKey: REXCZSJETIUQFU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 5-benzyl-2-methyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | REXCZSJETIUQFU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)