Products 1429902-34-0
CAS 1429902-34-0 is the registry number for 5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxylic acid (CAS 1429902-34-0) is a chemical compound with the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. IUPAC name: 5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: TWMJTCGYMWSPCP-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO3 |
|---|---|
| Molecular weight | 259.18 g/mol |
| IUPAC name | 5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | TWMJTCGYMWSPCP-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC(=C(C(=C2)F)F)F)C(=O)O |
Computed by PubChem (NCBI)