CAS 143016-68-6 appears in our catalog under these names: Omeprazole Impurity 18, 4-Chloro-2-(chloromethyl)-3,5-dimethylpyridine Hydrochloride, >95% (HPLC), Pyridine, 4-chloro-2-(chloromethyl)-3,5-dimethyl-, hydrochloride (1:1), 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 1g, 50mg, 100mg, 250mg.
4-chloro-2-(chloromethyl)-3,5-dimethylpyridine;hydrochloride (CAS 143016-68-6) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 4-chloro-2-(chloromethyl)-3,5-dimethylpyridine;hydrochloride. InChIKey: UZYOEPBKRIJNLU-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 4-chloro-2-(chloromethyl)-3,5-dimethylpyridine;hydrochloride |
| InChIKey | UZYOEPBKRIJNLU-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1Cl)C)CCl.Cl |
Computed by PubChem (NCBI)