CAS 143074-76-4 appears in our catalog under these names: 5,7-Dichloroisoquinolin-1(2H)-one, 97%, 5,7-Dichloroisoquinolin-1(2H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5,7-dichloro-2H-isoquinolin-1-one (CAS 143074-76-4) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 5,7-dichloro-2H-isoquinolin-1-one. InChIKey: WGETXVFLGKZKCE-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 5,7-dichloro-2H-isoquinolin-1-one |
| InChIKey | WGETXVFLGKZKCE-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)