CAS 1430854-20-8 appears in our catalog under these names: 1-Amino-4,4-difluorocyclohexane-1-carboxylic acid hydrochloride, 95%, 1-amino-4,4-difluorocyclohexane-1-carboxylic acid hydrochloride, 98%, 1–Amino–4,4–difluorocyclohexanecarboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-amino-4,4-difluorocyclohexane-1-carboxylic acid;hydrochloride (CAS 1430854-20-8) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: 1-amino-4,4-difluorocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: FMIJJOSZELGCCZ-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | 1-amino-4,4-difluorocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | FMIJJOSZELGCCZ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(C(=O)O)N)(F)F.Cl |
Computed by PubChem (NCBI)