CAS 403503-70-8 appears in our catalog under these names: Methyl (2s)-4,4-difluoropiperidine-2-carboxylate,hydrochloride, 97%, Methyl (2s)-4,4-difluoropiperidine-2-carboxylate,hydrochloride, 95%, 95%, METHYL (2S)-4,4-DIFLUOROPIPERIDINE-2-CARBOXYLATE,HYDROCHLORIDE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 500mg.
Methyl (2S)-4,4-difluoropiperidine-2-carboxylate;hydrochloride (CAS 403503-70-8) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl (2S)-4,4-difluoropiperidine-2-carboxylate;hydrochloride. InChIKey: RBRJTFVCUPBHAH-JEDNCBNOSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoropiperidine-2-carboxylate;hydrochloride |
| InChIKey | RBRJTFVCUPBHAH-JEDNCBNOSA-N |
| SMILES | COC(=O)[C@@H]1CC(CCN1)(F)F.Cl |
Computed by PubChem (NCBI)