Products 1434141-66-8

CAS 1434141-66-8 appears in our catalog under these names: Methyl 5,5-difluoropiperidine-2-carboxylate hydrochloride, 95%, Methyl 5,5-difluoropiperidine-2-carboxylate hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5,5-difluoropiperidine-2-carboxylate;hydrochloride (CAS 1434141-66-8) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl 5,5-difluoropiperidine-2-carboxylate;hydrochloride. InChIKey: XRRRTHFWINXEBB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClF2NO2
Molecular weight215.62 g/mol
IUPAC namemethyl 5,5-difluoropiperidine-2-carboxylate;hydrochloride
InChIKeyXRRRTHFWINXEBB-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(CN1)(F)F.Cl

Computed by PubChem (NCBI)