Products 1892495-12-3

CAS 1892495-12-3 is the registry number for 3-(3,3-Difluoro-pyrrolidin-1-yl)-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3,3-difluoropyrrolidin-1-yl)propanoic acid;hydrochloride (CAS 1892495-12-3) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: 3-(3,3-difluoropyrrolidin-1-yl)propanoic acid;hydrochloride. InChIKey: QDSSOGMBZLUPCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClF2NO2
Molecular weight215.62 g/mol
IUPAC name3-(3,3-difluoropyrrolidin-1-yl)propanoic acid;hydrochloride
InChIKeyQDSSOGMBZLUPCJ-UHFFFAOYSA-N
SMILESC1CN(CC1(F)F)CCC(=O)O.Cl

Computed by PubChem (NCBI)