CAS 1823330-58-0 is the registry number for 2-Ethyl-4,4-difluoropyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-ethyl-4,4-difluoropyrrolidine-2-carboxylic acid;hydrochloride (CAS 1823330-58-0) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: 2-ethyl-4,4-difluoropyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: HZAHZHAJIKIGLV-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | 2-ethyl-4,4-difluoropyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | HZAHZHAJIKIGLV-UHFFFAOYSA-N |
| SMILES | CCC1(CC(CN1)(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)