CAS 2387565-77-5 is the registry number for Methyl (R)-4,4-difluoropiperidine-2-carboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Methyl (2R)-4,4-difluoropiperidine-2-carboxylate;hydrochloride (CAS 2387565-77-5) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl (2R)-4,4-difluoropiperidine-2-carboxylate;hydrochloride. InChIKey: RBRJTFVCUPBHAH-NUBCRITNSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | methyl (2R)-4,4-difluoropiperidine-2-carboxylate;hydrochloride |
| InChIKey | RBRJTFVCUPBHAH-NUBCRITNSA-N |
| SMILES | COC(=O)[C@H]1CC(CCN1)(F)F.Cl |
Computed by PubChem (NCBI)