Products 2580092-71-1

CAS 2580092-71-1 is the registry number for Methyl (R)-2-(4,4-difluoropyrrolidin-2-yl)acetate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetate;hydrochloride (CAS 2580092-71-1) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetate;hydrochloride. InChIKey: YDLMXADMRDAIJC-NUBCRITNSA-N.

Identity
Molecular formulaC7H12ClF2NO2
Molecular weight215.62 g/mol
IUPAC namemethyl 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetate;hydrochloride
InChIKeyYDLMXADMRDAIJC-NUBCRITNSA-N
SMILESCOC(=O)C[C@@H]1CC(CN1)(F)F.Cl

Computed by PubChem (NCBI)