CAS 2580092-71-1 is the registry number for Methyl (R)-2-(4,4-difluoropyrrolidin-2-yl)acetate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetate;hydrochloride (CAS 2580092-71-1) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: methyl 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetate;hydrochloride. InChIKey: YDLMXADMRDAIJC-NUBCRITNSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | methyl 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetate;hydrochloride |
| InChIKey | YDLMXADMRDAIJC-NUBCRITNSA-N |
| SMILES | COC(=O)C[C@@H]1CC(CN1)(F)F.Cl |
Computed by PubChem (NCBI)