CAS 1431699-56-7 appears in our catalog under these names: (R)-2-Nitro-alpha-methylbenzylamine Hydrochloride, (R)–1–(2–Nitrophenyl)ethanamine hydrochloride, (R)-2-Nitro-±-methylbenzylamine Hydrochloride, Benzenemethanamine, α-methyl-2-nitro-, hydrochloride (1:1), (αR)-, 95%, 95%, (R)-1-(2-Nitrophenyl)ethanamine hydrochloride, 96%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 1g, 250mg, 500mg, 100mg, 5g, 10g.
(1R)-1-(2-nitrophenyl)ethanamine;hydrochloride (CAS 1431699-56-7) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1R)-1-(2-nitrophenyl)ethanamine;hydrochloride. InChIKey: HFXVLGOYQIKRTO-FYZOBXCZSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1R)-1-(2-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | HFXVLGOYQIKRTO-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=CC=C1[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)