CAS 148657-37-8 appears in our catalog under these names: 1-(2-Nitrophenyl)ethan-1-amine hydrochloride, 95%, 1–(2–Nitrophenyl)ethan–1–amine hydrochloride, 1-(2-Nitrophenyl)ethan-1-amine hydrochloride, 1-(2-Nitrophenyl)ethan-1-amine hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 2g, 10g.
1-(2-nitrophenyl)ethanamine;hydrochloride (CAS 148657-37-8) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 1-(2-nitrophenyl)ethanamine;hydrochloride. InChIKey: HFXVLGOYQIKRTO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 1-(2-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | HFXVLGOYQIKRTO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)