CAS 1435933-70-2 appears in our catalog under these names: 3-Methoxymethcathinone Hydrochloride, 3–Methoxymethcathinone (hydrochloride), 1-(3-Methoxyphenyl)-2-(methylamino)propan-1-one, hydrochloride. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 250mg, 10mg, 5mg, 50mg, 100mg.
1-(3-methoxyphenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 1435933-70-2) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 1-(3-methoxyphenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: GYWCNBATYQYWMK-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | GYWCNBATYQYWMK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)OC)NC.Cl |
Computed by PubChem (NCBI)