Products 1437051-93-8
CAS 1437051-93-8 is the registry number for 4-[(Hydroxyimino)methyl]-2-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-(hydroxyiminomethyl)-2-methylbenzoic acid (CAS 1437051-93-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4-(hydroxyiminomethyl)-2-methylbenzoic acid. InChIKey: JXVSFQSFOGVVPY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 4-(hydroxyiminomethyl)-2-methylbenzoic acid |
| InChIKey | JXVSFQSFOGVVPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C=NO)C(=O)O |
Computed by PubChem (NCBI)