CAS 14383-40-5 is the registry number for 2,4-Dioxo-1-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dioxo-1-phenylpyrimidine-5-carboxylic acid (CAS 14383-40-5) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 2,4-dioxo-1-phenylpyrimidine-5-carboxylic acid. InChIKey: AYQZVCGEIWPVCK-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 2,4-dioxo-1-phenylpyrimidine-5-carboxylic acid |
| InChIKey | AYQZVCGEIWPVCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=O)NC2=O)C(=O)O |
Computed by PubChem (NCBI)