Products 143982-35-8
CAS 143982-35-8 appears in our catalog under these names: 2-(Dichloromethyl)imidazo[1,2-a]pyridine, 90%, 2-(Dichloromethyl)imidazo(1,2-a)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g.
2-(dichloromethyl)imidazo[1,2-a]pyridine (CAS 143982-35-8) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2-(dichloromethyl)imidazo[1,2-a]pyridine. InChIKey: PBXJBZGZZNDUJY-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2-(dichloromethyl)imidazo[1,2-a]pyridine |
| InChIKey | PBXJBZGZZNDUJY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C(Cl)Cl |
Computed by PubChem (NCBI)