CAS 683240-82-6 appears in our catalog under these names: 2,6-Dichloro-5-methyl-1H-1,3-benzodiazole, 98%, 2,6-Dichloro-5-methyl-1H-benzo(d)imidazole, 98%, 2,6–Dichloro–5–methyl–1H–1,3–benzodiazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 10mg.
2,5-dichloro-6-methyl-1H-benzimidazole (CAS 683240-82-6) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2,5-dichloro-6-methyl-1H-benzimidazole. InChIKey: HPHAJHDXIDEYPM-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2,5-dichloro-6-methyl-1H-benzimidazole |
| InChIKey | HPHAJHDXIDEYPM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)N=C(N2)Cl |
Computed by PubChem (NCBI)