CAS 2922282-84-4 is the registry number for 2,4-Dichloro-5,6-dimethylnicotinonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5,6-dimethylpyridine-3-carbonitrile (CAS 2922282-84-4) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2,4-dichloro-5,6-dimethylpyridine-3-carbonitrile. InChIKey: YRPQVGWSISVWGZ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2,4-dichloro-5,6-dimethylpyridine-3-carbonitrile |
| InChIKey | YRPQVGWSISVWGZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=C1Cl)C#N)Cl)C |
Computed by PubChem (NCBI)