CAS 300843-36-1 appears in our catalog under these names: 1-Chlorophthalazine hydrochloride, 1-Chlorophthalazine hydrochloride, 95%, 1-Chlorophthalazine hydrochloride, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-chlorophthalazine;hydrochloride (CAS 300843-36-1) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 1-chlorophthalazine;hydrochloride. InChIKey: VWXKUBPEUUXLPV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 1-chlorophthalazine;hydrochloride |
| InChIKey | VWXKUBPEUUXLPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN=C2Cl.Cl |
Computed by PubChem (NCBI)