CAS 1448260-10-3 is the registry number for 5,7-Dichloro-2-methyl-1H-pyrrolo[2,3-c]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2-methyl-1H-pyrrolo[2,3-c]pyridine (CAS 1448260-10-3) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 5,7-dichloro-2-methyl-1H-pyrrolo[2,3-c]pyridine. InChIKey: WGSWEVBTSZKHJW-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 5,7-dichloro-2-methyl-1H-pyrrolo[2,3-c]pyridine |
| InChIKey | WGSWEVBTSZKHJW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=NC(=C2N1)Cl)Cl |
Computed by PubChem (NCBI)