Products 109421-34-3
CAS 109421-34-3 appears in our catalog under these names: (4-Amino-3,5-dichlorophenyl)acetonitrile, 95%, 2-(4-Amino-3,5-dichlorophenyl)acetonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-(4-amino-3,5-dichlorophenyl)acetonitrile (CAS 109421-34-3) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2-(4-amino-3,5-dichlorophenyl)acetonitrile. InChIKey: VWGWNXCEKOBATM-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2-(4-amino-3,5-dichlorophenyl)acetonitrile |
| InChIKey | VWGWNXCEKOBATM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)CC#N |
Computed by PubChem (NCBI)