Products 1638771-47-7
CAS 1638771-47-7 appears in our catalog under these names: 4,6-Dichloro-3-methyl-1h-pyrrolo[2,3-b]pyridine, 95%, 4,6-Dichloro-3-methyl-1H-pyrrolo(2,3-b)pyridine, 97%, 4,6-Dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine, 96%, 96%, 4,6-Dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
4,6-dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine (CAS 1638771-47-7) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 4,6-dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: XTQKFSGVCGUOTN-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | XTQKFSGVCGUOTN-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=C1C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)