CAS 144152-23-8 appears in our catalog under these names: 5-Ethyl-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid, 95%, 5-Ethyl-1-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-ethyl-1-methyl-6-oxopyridine-3-carboxylic acid (CAS 144152-23-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-ethyl-1-methyl-6-oxopyridine-3-carboxylic acid. InChIKey: ZGECEPWDLKQSCH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-ethyl-1-methyl-6-oxopyridine-3-carboxylic acid |
| InChIKey | ZGECEPWDLKQSCH-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CN(C1=O)C)C(=O)O |
Computed by PubChem (NCBI)