Products 144449-06-9
CAS 144449-06-9 is the registry number for 6-Chloro-2-(phenylmethyl)imidazo[1,2-b]pyridazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-benzyl-6-chloroimidazo[1,2-b]pyridazine (CAS 144449-06-9) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 2-benzyl-6-chloroimidazo[1,2-b]pyridazine. InChIKey: QBEWCTKGDYLTBZ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-benzyl-6-chloroimidazo[1,2-b]pyridazine |
| InChIKey | QBEWCTKGDYLTBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CN3C(=N2)C=CC(=N3)Cl |
Computed by PubChem (NCBI)