CAS 144540-75-0 is the registry number for Perindopril Related Compound 1 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid;hydrochloride (CAS 144540-75-0) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid;hydrochloride. InChIKey: PONAUWFRJYNGAC-MWDCIYOWSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | (2S,3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid;hydrochloride |
| InChIKey | PONAUWFRJYNGAC-MWDCIYOWSA-N |
| SMILES | C1CC[C@H]2[C@H](C1)C[C@H](N2)C(=O)O.Cl |
Computed by PubChem (NCBI)