CAS 144735-14-8 is the registry number for p-DCSB. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(dimethylamino)phenyl]-3H-indene-5-carbonitrile (CAS 144735-14-8) is a chemical compound with the molecular formula C18H16N2 and a molecular weight of 260.3 g/mol. IUPAC name: 2-[4-(dimethylamino)phenyl]-3H-indene-5-carbonitrile. InChIKey: GGXGQXQWJBJLIO-UHFFFAOYSA-N.
| Molecular formula | C18H16N2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 2-[4-(dimethylamino)phenyl]-3H-indene-5-carbonitrile |
| InChIKey | GGXGQXQWJBJLIO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC3=C(C2)C=C(C=C3)C#N |
Computed by PubChem (NCBI)