Products 1447942-31-5
CAS 1447942-31-5 is the registry number for rel-(2r,3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (CAS 1447942-31-5) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: (3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid. InChIKey: IGXNQYGTWBASGP-DGUCWDHESA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3aR,6aS)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| InChIKey | IGXNQYGTWBASGP-DGUCWDHESA-N |
| SMILES | C1[C@@H]2CC(C[C@@H]2CC1C(=O)O)(F)F |
Computed by PubChem (NCBI)