Products 1784979-78-7
CAS 1784979-78-7 appears in our catalog under these names: 5，5–Difluorooctahydropentalene–2–carboxylic acid, 5,5-Difluorooctahydropentalene-2-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (CAS 1784979-78-7) is a chemical compound with the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. IUPAC name: 5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid. InChIKey: IGXNQYGTWBASGP-UHFFFAOYSA-N.
| Molecular formula | C9H12F2O2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| InChIKey | IGXNQYGTWBASGP-UHFFFAOYSA-N |
| SMILES | C1C(CC2C1CC(C2)(F)F)C(=O)O |
Computed by PubChem (NCBI)