Products 1451392-11-2

CAS 1451392-11-2 is the registry number for 4-Methoxy-2-(pyrrolidin-1-ylmethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[4-methoxy-2-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1451392-11-2) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [4-methoxy-2-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: YRVRIOGRGSVNMN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18BNO3
Molecular weight235.09 g/mol
IUPAC name[4-methoxy-2-(pyrrolidin-1-ylmethyl)phenyl]boronic acid
InChIKeyYRVRIOGRGSVNMN-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)OC)CN2CCCC2)(O)O

Computed by PubChem (NCBI)