CAS 1453211-50-1 is the registry number for 1-Ethynyl-2-fluoro-3,5-dimethoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethynyl-2-fluoro-3,5-dimethoxybenzene (CAS 1453211-50-1) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 1-ethynyl-2-fluoro-3,5-dimethoxybenzene. InChIKey: RDLDIZODNZSRRQ-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 1-ethynyl-2-fluoro-3,5-dimethoxybenzene |
| InChIKey | RDLDIZODNZSRRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)F)C#C |
Computed by PubChem (NCBI)