CAS 1455-87-4 is the registry number for N,N-Dimethylamino-7-nitrobenzofurazan. Offered by: Chemat. Available pack sizes: 250mg.
N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-7-amine (CAS 1455-87-4) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-7-amine. InChIKey: JKWNQFKDTSTWGL-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | N,N-dimethyl-4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChIKey | JKWNQFKDTSTWGL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C2=NON=C12)[N+](=O)[O-] |
Computed by PubChem (NCBI)