Products 145689-41-4
CAS 145689-41-4 appears in our catalog under these names: 2,3–Difluorophenylacetic acid, 2,3-Difluorophenylacetic acid, 98% , 2,3-Difluorophenylacetic acid, 2-(2,3-Difluorophenyl)acetic acid 98%, 2-(2,3-Difluorophenyl)acetic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 250g, 1x100mg.
2-(2,3-difluorophenyl)acetic acid (CAS 145689-41-4) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2-(2,3-difluorophenyl)acetic acid. InChIKey: UXSQXUSJGPVOKT-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)acetic acid |
| InChIKey | UXSQXUSJGPVOKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CC(=O)O |
Computed by PubChem (NCBI)