CAS 145742-63-8 is the registry number for 2-(Difluoromethoxy)-5-nitrobenzaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(difluoromethoxy)-5-nitrobenzaldehyde (CAS 145742-63-8) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(difluoromethoxy)-5-nitrobenzaldehyde. InChIKey: YERTUMJMWKSDIU-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(difluoromethoxy)-5-nitrobenzaldehyde |
| InChIKey | YERTUMJMWKSDIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C=O)OC(F)F |
Computed by PubChem (NCBI)