Products 145887-88-3
CAS 145887-88-3 is the registry number for Nor-Cerpegin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,1-dimethyl-5H-furo[3,4-c]pyridine-3,4-dione (CAS 145887-88-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1,1-dimethyl-5H-furo[3,4-c]pyridine-3,4-dione. InChIKey: KHMVIOWJEDISGR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1,1-dimethyl-5H-furo[3,4-c]pyridine-3,4-dione |
| InChIKey | KHMVIOWJEDISGR-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=O)NC=C2)C(=O)O1)C |
Computed by PubChem (NCBI)