Products 14842-41-2
CAS 14842-41-2 appears in our catalog under these names: Pidotimod Impurity A, Pidotimod Impurity 6, (5aS,10aS)-Tetrahydrodipyrrolo(1,2-a:1',2'-d)pyrazine-3,5,8,10(2H,5aH)-tetraone, (5aS,10aS)-Tetrahydrodipyrrolo[1,2-a:1',2'-d]pyrazine-3,5,8,10(2H,5aH)-tetraone, 95+%, 95+%. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2g, 1g.
(3S,9S)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,6,8,12-tetrone (CAS 14842-41-2) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: (3S,9S)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,6,8,12-tetrone. InChIKey: TXFYQWADOFKHHB-WDSKDSINSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | (3S,9S)-1,7-diazatricyclo[7.3.0.03,7]dodecane-2,6,8,12-tetrone |
| InChIKey | TXFYQWADOFKHHB-WDSKDSINSA-N |
| SMILES | C1CC(=O)N2[C@@H]1C(=O)N3[C@H](C2=O)CCC3=O |
Computed by PubChem (NCBI)