Products 1461689-20-2

CAS 1461689-20-2 appears in our catalog under these names: (2S)-2-Amino-3-cycloheptylpropanoic acid hydrochloride, (S)-2-Amino-3-cycloheptylpropanoic acid hydrochloride, 97%, (2S)-2-Amino-3-cycloheptyl-propanoic acid hydrochloride, 97%, 97%, (2S)-2-Amino-3-cycloheptyl-propanoic acid hydrochloride, 97%. Offered by: Biosynth, AmBeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 5g, 100mg, 250mg, 500mg, 1g.

(2S)-2-amino-3-cycloheptylpropanoic acid;hydrochloride (CAS 1461689-20-2) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: (2S)-2-amino-3-cycloheptylpropanoic acid;hydrochloride. InChIKey: IRYFVVIIPWXKCT-FVGYRXGTSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name(2S)-2-amino-3-cycloheptylpropanoic acid;hydrochloride
InChIKeyIRYFVVIIPWXKCT-FVGYRXGTSA-N
SMILESC1CCCC(CC1)C[C@@H](C(=O)O)N.Cl

Computed by PubChem (NCBI)