CAS 57731-07-4 is the registry number for (4Z)-2-methyl-4-[(3-nitrophenyl)methylidene]-4,5-dihydro-1,3-oxazol-5-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-methyl-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one (CAS 57731-07-4) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 2-methyl-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one. InChIKey: ABNNCLKVUMXLSZ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 2-methyl-4-[(3-nitrophenyl)methylidene]-1,3-oxazol-5-one |
| InChIKey | ABNNCLKVUMXLSZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC2=CC(=CC=C2)[N+](=O)[O-])C(=O)O1 |
Computed by PubChem (NCBI)