CAS 146565-98-2 is the registry number for m,p-O-Dimethyl-L-threo-droxidopa. Offered by: TRC. Available pack sizes: 100mg.
(2S,3R)-2-amino-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoic acid (CAS 146565-98-2) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: (2S,3R)-2-amino-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoic acid. InChIKey: ZKPVWZDNDNCTBB-VHSXEESVSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-(3,4-dimethoxyphenyl)-3-hydroxypropanoic acid |
| InChIKey | ZKPVWZDNDNCTBB-VHSXEESVSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]([C@@H](C(=O)O)N)O)OC |
Computed by PubChem (NCBI)