CAS 146680-78-6 is the registry number for 4''-Diethylamino-3-hydroxyflavone. Offered by: Chemat. Available pack sizes: 100mg, 50mg.
2-[4-(diethylamino)phenyl]-3-hydroxychromen-4-one (CAS 146680-78-6) is a chemical compound with the molecular formula C19H19NO3 and a molecular weight of 309.4 g/mol. IUPAC name: 2-[4-(diethylamino)phenyl]-3-hydroxychromen-4-one. InChIKey: NTRKEYLXTPNPIY-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-[4-(diethylamino)phenyl]-3-hydroxychromen-4-one |
| InChIKey | NTRKEYLXTPNPIY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)