Products 1466869-19-1
CAS 1466869-19-1 is the registry number for tert-Butyl 3-chloroisonicotinate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-chloropyridine-4-carboxylate (CAS 1466869-19-1) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 3-chloropyridine-4-carboxylate. InChIKey: OMTHMTRLZQHWHR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 3-chloropyridine-4-carboxylate |
| InChIKey | OMTHMTRLZQHWHR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=NC=C1)Cl |
Computed by PubChem (NCBI)